C25H17N5O5 — CID 42979596
[1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate (PubChem CID 42979596) has the molecular formula C25H17N5O5 and a molecular weight of 467.44 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 42979596 |
| Molecular Formula | C25H17N5O5 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H17N5O5/c1-14(35-25(34)15-6-9-17(10-7-15)30-13-26-28-29-30)24(33)27-16-8-11-20-21(12-16)23(32)19-5-3-2-4-18(19)22(20)31/h2-14H,1H3,(H,27,33) |
| InChIKey | WYWJWAUTSZIJFJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|