C19H19FN6O2 — CID 55991992
N-[1-[2-fluoro-5-(tetrazol-1-yl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 55991992) has the molecular formula C19H19FN6O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is N-[1-[2-fluoro-5-(tetrazol-1-yl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[2-fluoro-5-(tetrazol-1-yl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55991992 |
| Molecular Formula | C19H19FN6O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[1-[2-fluoro-5-(tetrazol-1-yl)anilino]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1)C(=O)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C19H19FN6O2/c1-12(2)17(23-18(27)13-6-4-3-5-7-13)19(28)22-16-10-14(8-9-15(16)20)26-11-21-24-25-26/h3-12,17H,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | NAGXGNGYUWVLAA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |