C15H20FN7O2 — CID 118776038
1-[2-fluoro-5-(tetrazol-1-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 118776038) has the molecular formula C15H20FN7O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is 1-[2-fluoro-5-(tetrazol-1-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[2-fluoro-5-(tetrazol-1-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 118776038 |
| Molecular Formula | C15H20FN7O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[2-fluoro-5-(tetrazol-1-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | O=C(NCCCN1CCOCC1)Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C15H20FN7O2/c16-13-3-2-12(23-11-18-20-21-23)10-14(13)19-15(24)17-4-1-5-22-6-8-25-9-7-22/h2-3,10-11H,1,4-9H2,(H2,17,19,24) |
| InChIKey | KYKXNDXILNTKQD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|