C14H20F3N3O3 — CID 2811707
1-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 2811707) has the molecular formula C14H20F3N3O3 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 2811707 |
| Molecular Formula | C14H20F3N3O3 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | Cc1cc(NC(=O)NCCCN2CCOCC2)c(C(F)(F)F)o1 |
| InChI | InChI=1S/C14H20F3N3O3/c1-10-9-11(12(23-10)14(15,16)17)19-13(21)18-3-2-4-20-5-7-22-8-6-20/h9H,2-8H2,1H3,(H2,18,19,21) |
| InChIKey | PPGHQUXNFILBPO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|