C23H33ClF3N5O4 — CID 3719727
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N,N'-bis(3-morpholin-4-ylpropyl)propanediamide (PubChem CID 3719727) has the molecular formula C23H33ClF3N5O4 and a molecular weight of 536.00 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N,N'-bis(3-morpholin-4-ylpropyl)propanediamide.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N,N'-bis(3-morpholin-4-ylpropyl)propanediamide |
|---|---|
| PubChem CID | 3719727 |
| Molecular Formula | C23H33ClF3N5O4 |
| Molecular Weight | 536.00 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N,N'-bis(3-morpholin-4-ylpropyl)propanediamide |
| SMILES | O=C(NCCCN1CCOCC1)C(C(=O)NCCCN1CCOCC1)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H33ClF3N5O4/c24-18-15-17(23(25,26)27)16-30-20(18)19(21(33)28-3-1-5-31-7-11-35-12-8-31)22(34)29-4-2-6-32-9-13-36-14-10-32/h15-16,19H,1-14H2,(H,28,33)(H,29,34) |
| InChIKey | QDTKFZJHHCHOCN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.00 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|