C17H25ClN2O3 — CID 3973227
2-(4-chlorophenoxy)-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 3973227) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | 2-(4-chlorophenoxy)-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 3973227 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-(4-chlorophenoxy)-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-17(2,23-15-6-4-14(18)5-7-15)16(21)19-8-3-9-20-10-12-22-13-11-20/h4-7H,3,8-13H2,1-2H3,(H,19,21) |
| InChIKey | OZQSQVNXMYCYGY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|