C11H20Cl2N2O2 — CID 7375440
(2R)-2,3-dichloro-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide (PubChem CID 7375440) has the molecular formula C11H20Cl2N2O2 and a molecular weight of 283.20 g/mol. Its IUPAC name is (2R)-2,3-dichloro-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide.
| Compound Name | (2R)-2,3-dichloro-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 7375440 |
| Molecular Formula | C11H20Cl2N2O2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2R)-2,3-dichloro-2-methyl-N-(3-morpholin-4-ylpropyl)propanamide |
| SMILES | C[C@](Cl)(CCl)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C11H20Cl2N2O2/c1-11(13,9-12)10(16)14-3-2-4-15-5-7-17-8-6-15/h2-9H2,1H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | SVJREBIUKKILBR-NSHDSACASA-N |
| XLogP | 1.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|