C17H32N4O4 — CID 21205309
N,N'-bis(3-morpholin-4-ylpropyl)propanediamide (PubChem CID 21205309) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is N,N'-bis(3-morpholin-4-ylpropyl)propanediamide.
| Compound Name | N,N'-bis(3-morpholin-4-ylpropyl)propanediamide |
|---|---|
| PubChem CID | 21205309 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | N,N'-bis(3-morpholin-4-ylpropyl)propanediamide |
| SMILES | O=C(CC(=O)NCCCN1CCOCC1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H32N4O4/c22-16(18-3-1-5-20-7-11-24-12-8-20)15-17(23)19-4-2-6-21-9-13-25-14-10-21/h1-15H2,(H,18,22)(H,19,23) |
| InChIKey | GHELOQVJJHSGRL-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|