C13H29Cl2N3O3 — CID 119852507
2-(2-methoxyethylamino)-N-(4-morpholin-4-ylbutyl)acetamide;dihydrochloride (PubChem CID 119852507) has the molecular formula C13H29Cl2N3O3 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(4-morpholin-4-ylbutyl)acetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(4-morpholin-4-ylbutyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119852507 |
| Molecular Formula | C13H29Cl2N3O3 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(4-morpholin-4-ylbutyl)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NCCCCN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C13H27N3O3.2ClH/c1-18-9-5-14-12-13(17)15-4-2-3-6-16-7-10-19-11-8-16;;/h14H,2-12H2,1H3,(H,15,17);2*1H |
| InChIKey | OWVPSTHBLWHBAA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|