C12H25N3O3 — CID 108994050
2-(3-methoxypropylamino)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 108994050) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(3-methoxypropylamino)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(3-methoxypropylamino)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 108994050 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(3-methoxypropylamino)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | COCCCNCC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C12H25N3O3/c1-17-8-2-3-13-11-12(16)14-4-5-15-6-9-18-10-7-15/h13H,2-11H2,1H3,(H,14,16) |
| InChIKey | MQRJXQKHYAGPDA-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|