C17H25N3O5 — CID 110285157
3,5-dimethoxy-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]benzamide (PubChem CID 110285157) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110285157 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3,5-dimethoxy-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C17H25N3O5/c1-23-14-9-13(10-15(11-14)24-2)17(22)19-12-16(21)18-3-4-20-5-7-25-8-6-20/h9-11H,3-8,12H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | GKFMPHGMVZIXPL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |