C15H21NO5 — CID 50896866
2-morpholin-4-ylethyl 3,5-dimethoxybenzoate (PubChem CID 50896866) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 3,5-dimethoxybenzoate.
| Compound Name | 2-morpholin-4-ylethyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 50896866 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-morpholin-4-ylethyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C15H21NO5/c1-18-13-9-12(10-14(11-13)19-2)15(17)21-8-5-16-3-6-20-7-4-16/h9-11H,3-8H2,1-2H3 |
| InChIKey | NCRSTLPTMCGJDM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |