C15H22ClNO5 — CID 660605
hydron;2-morpholin-4-ylethyl 3,4-dimethoxybenzoate;chloride (PubChem CID 660605) has the molecular formula C15H22ClNO5 and a molecular weight of 331.80 g/mol. Its IUPAC name is hydron;2-morpholin-4-ylethyl 3,4-dimethoxybenzoate;chloride.
| Compound Name | hydron;2-morpholin-4-ylethyl 3,4-dimethoxybenzoate;chloride |
|---|---|
| PubChem CID | 660605 |
| Molecular Formula | C15H22ClNO5 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | hydron;2-morpholin-4-ylethyl 3,4-dimethoxybenzoate;chloride |
| SMILES | COc1ccc(C(=O)OCCN2CCOCC2)cc1OC.[Cl-].[H+] |
| InChI | InChI=1S/C15H21NO5.ClH/c1-18-13-4-3-12(11-14(13)19-2)15(17)21-10-7-16-5-8-20-9-6-16;/h3-4,11H,5-10H2,1-2H3;1H |
| InChIKey | ZIPHSYUICCKNIX-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |