About 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride
2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride (PubChem CID 2836400) has the molecular formula C14H20ClNO4
and a molecular weight of 301.77 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride |
| PubChem CID | 2836400 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride |
| SMILES | COc1ccc(C(=O)OCCN2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C14H19NO4.ClH/c1-17-13-4-2-12(3-5-13)14(16)19-11-8-15-6-9-18-10-7-15;/h2-5H,6-11H2,1H3;1H |
| InChIKey | IZDYEDJMHACGPO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride (CID 2836400) is 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride is COc1ccc(C(=O)OCCN2CCOCC2)cc1.Cl.
What is the InChIKey of 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride?
The InChIKey is IZDYEDJMHACGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4.ClH/c1-17-13-4-2-12(3-5-13)14(16)19-11-8-15-6-9-18-10-7-15;/h2-5H,6-11H2,1H3;1H.
What are the key properties of 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride?
2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride has a molecular weight of 301.77 g/mol, XLogP of 1.61, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 4-methoxybenzoate;hydrochloride is sourced from PubChem (CID 2836400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).