C25H35NO10 — CID 12073682
2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)ethyl 7-methoxy-2-oxochromene-3-carboxylate (PubChem CID 12073682) has the molecular formula C25H35NO10 and a molecular weight of 509.55 g/mol. Its IUPAC name is 2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)ethyl 7-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | 2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)ethyl 7-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 12073682 |
| Molecular Formula | C25H35NO10 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 2-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)ethyl 7-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OCCN3CCOCCOCCOCCOCCOCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H35NO10/c1-29-21-3-2-20-18-22(25(28)36-23(20)19-21)24(27)35-9-6-26-4-7-30-10-12-32-14-16-34-17-15-33-13-11-31-8-5-26/h2-3,18-19H,4-17H2,1H3 |
| InChIKey | YUYGXCZKUGDYNH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 115.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|