About 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate
2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate (PubChem CID 68605488) has the molecular formula C13H17BrN2O4
and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate |
| PubChem CID | 68605488 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate |
| SMILES | Cn1cc(Br)cc(C(=O)OCCN2CCOCC2)c1=O |
| InChI | InChI=1S/C13H17BrN2O4/c1-15-9-10(14)8-11(12(15)17)13(18)20-7-4-16-2-5-19-6-3-16/h8-9H,2-7H2,1H3 |
| InChIKey | UYMAWUWXHDFTAJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate (CID 68605488) is 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate is Cn1cc(Br)cc(C(=O)OCCN2CCOCC2)c1=O.
What is the InChIKey of 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate?
The InChIKey is UYMAWUWXHDFTAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN2O4/c1-15-9-10(14)8-11(12(15)17)13(18)20-7-4-16-2-5-19-6-3-16/h8-9H,2-7H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate?
2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate has a molecular weight of 345.19 g/mol, XLogP of 0.64, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 5-bromo-1-methyl-2-oxopyridine-3-carboxylate is sourced from PubChem (CID 68605488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).