About 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate
2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate (PubChem CID 162508735) has the molecular formula C11H18BrNO4
and a molecular weight of 308.17 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate |
| PubChem CID | 162508735 |
| Molecular Formula | C11H18BrNO4 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)(Br)C(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C11H18BrNO4/c1-9(14)11(2,12)10(15)17-8-5-13-3-6-16-7-4-13/h3-8H2,1-2H3 |
| InChIKey | IKRUALWKZLGBOR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate?
The IUPAC name of 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate (CID 162508735) is 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate?
The canonical SMILES for 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate is CC(=O)C(C)(Br)C(=O)OCCN1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate?
The InChIKey is IKRUALWKZLGBOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrNO4/c1-9(14)11(2,12)10(15)17-8-5-13-3-6-16-7-4-13/h3-8H2,1-2H3.
What are the key properties of 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate?
2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate has a molecular weight of 308.17 g/mol, XLogP of 0.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-bromo-2-methyl-3-oxobutanoate is sourced from PubChem (CID 162508735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).