C30H58N2O8 — CID 102070429
2-[16-[2-(4,4-dimethylpentanoyloxy)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl 4,4-dimethylpentanoate (PubChem CID 102070429) has the molecular formula C30H58N2O8 and a molecular weight of 574.80 g/mol. Its IUPAC name is 2-[16-[2-(4,4-dimethylpentanoyloxy)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl 4,4-dimethylpentanoate.
| Compound Name | 2-[16-[2-(4,4-dimethylpentanoyloxy)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 102070429 |
| Molecular Formula | C30H58N2O8 |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.42 |
| IUPAC Name | 2-[16-[2-(4,4-dimethylpentanoyloxy)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]ethyl 4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CCC(=O)OCCN1CCOCCOCCN(CCOC(=O)CCC(C)(C)C)CCOCCOCC1 |
| InChI | InChI=1S/C30H58N2O8/c1-29(2,3)9-7-27(33)39-21-15-31-11-17-35-23-25-37-19-13-32(14-20-38-26-24-36-18-12-31)16-22-40-28(34)8-10-30(4,5)6/h7-26H2,1-6H3 |
| InChIKey | VIVVVSDKCCSFJJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |