About 2-morpholin-4-ylethyl octanoate
2-morpholin-4-ylethyl octanoate (PubChem CID 23118480) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl octanoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl octanoate |
| PubChem CID | 23118480 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 2-morpholin-4-ylethyl octanoate |
| SMILES | CCCCCCCC(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C14H27NO3/c1-2-3-4-5-6-7-14(16)18-13-10-15-8-11-17-12-9-15/h2-13H2,1H3 |
| InChIKey | ZKTLPKQFIRBDNY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-ylethyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl octanoate?
The IUPAC name of 2-morpholin-4-ylethyl octanoate (CID 23118480) is 2-morpholin-4-ylethyl octanoate.
What is the SMILES notation for 2-morpholin-4-ylethyl octanoate?
The canonical SMILES for 2-morpholin-4-ylethyl octanoate is CCCCCCCC(=O)OCCN1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylethyl octanoate?
The InChIKey is ZKTLPKQFIRBDNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-2-3-4-5-6-7-14(16)18-13-10-15-8-11-17-12-9-15/h2-13H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl octanoate?
2-morpholin-4-ylethyl octanoate has a molecular weight of 257.37 g/mol, XLogP of 2.22, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl octanoate is sourced from PubChem (CID 23118480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).