About 2-piperidin-1-ylethyl hexanoate
2-piperidin-1-ylethyl hexanoate (PubChem CID 59204070) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl hexanoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl hexanoate |
| PubChem CID | 59204070 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-piperidin-1-ylethyl hexanoate |
| SMILES | CCCCCC(=O)OCCN1CCCCC1 |
| InChI | InChI=1S/C13H25NO2/c1-2-3-5-8-13(15)16-12-11-14-9-6-4-7-10-14/h2-12H2,1H3 |
| InChIKey | ZRTKPZKISPGPLY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl hexanoate?
The IUPAC name of 2-piperidin-1-ylethyl hexanoate (CID 59204070) is 2-piperidin-1-ylethyl hexanoate.
What is the SMILES notation for 2-piperidin-1-ylethyl hexanoate?
The canonical SMILES for 2-piperidin-1-ylethyl hexanoate is CCCCCC(=O)OCCN1CCCCC1.
What is the InChIKey of 2-piperidin-1-ylethyl hexanoate?
The InChIKey is ZRTKPZKISPGPLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-2-3-5-8-13(15)16-12-11-14-9-6-4-7-10-14/h2-12H2,1H3.
What are the key properties of 2-piperidin-1-ylethyl hexanoate?
2-piperidin-1-ylethyl hexanoate has a molecular weight of 227.35 g/mol, XLogP of 2.60, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl hexanoate is sourced from PubChem (CID 59204070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).