C24H45NO4S — CID 76740441
2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl octadec-9-enoate (PubChem CID 76740441) has the molecular formula C24H45NO4S and a molecular weight of 443.69 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl octadec-9-enoate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl octadec-9-enoate |
|---|---|
| PubChem CID | 76740441 |
| Molecular Formula | C24H45NO4S |
| Molecular Weight | 443.69 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C24H45NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(26)29-21-18-25-19-22-30(27,28)23-20-25/h9-10H,2-8,11-23H2,1H3 |
| InChIKey | PLZLWYLOTNXBTM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|