C54H98N2O7S — CID 170187356
[7-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 170187356) has the molecular formula C54H98N2O7S and a molecular weight of 919.45 g/mol. Its IUPAC name is [7-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [7-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170187356 |
| Molecular Formula | C54H98N2O7S |
| Molecular Weight | 919.45 g/mol |
| Exact Mass | 918.71 |
| IUPAC Name | [7-[[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCCC(O)C(CCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CNCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C54H98N2O7S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33-40-53(58)62-46-36-31-32-39-52(57)51(50-55-42-43-56-44-48-64(60,61)49-45-56)38-35-37-47-63-54(59)41-34-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,51-52,55,57H,3-10,15-16,21-50H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | JXWUZAAEJMXHAI-MAZCIEHSSA-N |
| XLogP | 12.73 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.45 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|