C57H106N2O5 — CID 170187415
[7-[[3-(dibutylamino)propylamino]methyl]-11-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-6-hydroxyundecyl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 170187415) has the molecular formula C57H106N2O5 and a molecular weight of 899.48 g/mol. Its IUPAC name is [7-[[3-(dibutylamino)propylamino]methyl]-11-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-6-hydroxyundecyl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [7-[[3-(dibutylamino)propylamino]methyl]-11-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-6-hydroxyundecyl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170187415 |
| Molecular Formula | C57H106N2O5 |
| Molecular Weight | 899.48 g/mol |
| Exact Mass | 898.81 |
| IUPAC Name | [7-[[3-(dibutylamino)propylamino]methyl]-11-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-6-hydroxyundecyl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCCC(O)C(CCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCC)CNCCCN(CCCC)CCCC |
| InChI | InChI=1S/C57H106N2O5/c1-5-9-13-15-17-19-21-23-25-27-29-31-33-37-45-56(61)63-51-40-35-36-44-55(60)54(53-58-47-42-50-59(48-11-7-3)49-12-8-4)43-39-41-52-64-57(62)46-38-34-32-30-28-26-24-22-20-18-16-14-10-6-2/h15-18,21-24,54-55,58,60H,5-14,19-20,25-53H2,1-4H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | NFWCFWMFNKXGBW-MLLZQYMOSA-N |
| XLogP | 15.51 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.48 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|