C53H98N2O5 — CID 170187346
[7-[[3-(dimethylamino)propylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 170187346) has the molecular formula C53H98N2O5 and a molecular weight of 843.38 g/mol. Its IUPAC name is [7-[[3-(dimethylamino)propylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [7-[[3-(dimethylamino)propylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 170187346 |
| Molecular Formula | C53H98N2O5 |
| Molecular Weight | 843.38 g/mol |
| Exact Mass | 842.75 |
| IUPAC Name | [7-[[3-(dimethylamino)propylamino]methyl]-6-hydroxy-11-[(9Z,12Z)-octadeca-9,12-dienoyl]oxyundecyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCCCC(O)C(CCCCOC(=O)CCCCCCC/C=C\C/C=C\CCCCC)CNCCCN(C)C |
| InChI | InChI=1S/C53H98N2O5/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-43-52(57)59-47-38-33-34-42-51(56)50(49-54-45-40-46-55(3)4)41-37-39-48-60-53(58)44-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,50-51,54,56H,5-12,17-18,23-49H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | ZYKVPVXUDFJJFB-KWXKLSQISA-N |
| XLogP | 13.95 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.38 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|