C43H82N2O — CID 176897450
(6Z,9Z,29Z,32Z)-20-[[2-(dimethylamino)ethylamino]methyl]octatriaconta-6,9,29,32-tetraen-19-ol (PubChem CID 176897450) has the molecular formula C43H82N2O and a molecular weight of 643.14 g/mol. Its IUPAC name is (6Z,9Z,29Z,32Z)-20-[[2-(dimethylamino)ethylamino]methyl]octatriaconta-6,9,29,32-tetraen-19-ol.
| Compound Name | (6Z,9Z,29Z,32Z)-20-[[2-(dimethylamino)ethylamino]methyl]octatriaconta-6,9,29,32-tetraen-19-ol |
|---|---|
| PubChem CID | 176897450 |
| Molecular Formula | C43H82N2O |
| Molecular Weight | 643.14 g/mol |
| Exact Mass | 642.64 |
| IUPAC Name | (6Z,9Z,29Z,32Z)-20-[[2-(dimethylamino)ethylamino]methyl]octatriaconta-6,9,29,32-tetraen-19-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(O)C(CCCCCCCC/C=C\C/C=C\CCCCC)CNCCN(C)C |
| InChI | InChI=1S/C43H82N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(41-44-39-40-45(3)4)43(46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-44,46H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | PIRXORDQJJFSCP-KWXKLSQISA-N |
| XLogP | 12.52 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.14 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|