C45H87N3 — CID 86304988
1-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-6-N,6-N-dimethylhexane-1,2,6-triamine (PubChem CID 86304988) has the molecular formula C45H87N3 and a molecular weight of 670.21 g/mol. Its IUPAC name is 1-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-6-N,6-N-dimethylhexane-1,2,6-triamine.
| Compound Name | 1-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-6-N,6-N-dimethylhexane-1,2,6-triamine |
|---|---|
| PubChem CID | 86304988 |
| Molecular Formula | C45H87N3 |
| Molecular Weight | 670.21 g/mol |
| Exact Mass | 669.69 |
| IUPAC Name | 1-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]-6-N,6-N-dimethylhexane-1,2,6-triamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NCC(N)CCCCN(C)C |
| InChI | InChI=1S/C45H87N3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-45(47-43-44(46)39-37-38-42-48(3)4)41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,44-45,47H,5-12,17-18,23-43,46H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | VLIGYPIVRQQFGA-KWXKLSQISA-N |
| XLogP | 13.41 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.21 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|