C44H84N4O — CID 139508910
2-amino-6-(dimethylamino)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]hexanehydrazide (PubChem CID 139508910) has the molecular formula C44H84N4O and a molecular weight of 685.18 g/mol. Its IUPAC name is 2-amino-6-(dimethylamino)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]hexanehydrazide.
| Compound Name | 2-amino-6-(dimethylamino)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]hexanehydrazide |
|---|---|
| PubChem CID | 139508910 |
| Molecular Formula | C44H84N4O |
| Molecular Weight | 685.18 g/mol |
| Exact Mass | 684.66 |
| IUPAC Name | 2-amino-6-(dimethylamino)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]hexanehydrazide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)NC(=O)C(N)CCCCN(C)C |
| InChI | InChI=1S/C44H84N4O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-41-48(46-44(49)43(45)39-35-38-40-47(3)4)42-37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43H,5-12,17-18,23-42,45H2,1-4H3,(H,46,49)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | CMZVMMOUEVEBNB-KWXKLSQISA-N |
| XLogP | 12.01 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.18 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|