C44H79NO4 — CID 76830266
bis(octadeca-9,12-dienyl) 2-[3-(dimethylamino)propyl]propanedioate (PubChem CID 76830266) has the molecular formula C44H79NO4 and a molecular weight of 686.12 g/mol. Its IUPAC name is bis(octadeca-9,12-dienyl) 2-[3-(dimethylamino)propyl]propanedioate.
| Compound Name | bis(octadeca-9,12-dienyl) 2-[3-(dimethylamino)propyl]propanedioate |
|---|---|
| PubChem CID | 76830266 |
| Molecular Formula | C44H79NO4 |
| Molecular Weight | 686.12 g/mol |
| Exact Mass | 685.60 |
| IUPAC Name | bis(octadeca-9,12-dienyl) 2-[3-(dimethylamino)propyl]propanedioate |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC(=O)C(CCCN(C)C)C(=O)OCCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C44H79NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-48-43(46)42(38-37-39-45(3)4)44(47)49-41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42H,5-12,17-18,23-41H2,1-4H3 |
| InChIKey | HLSQVOPGXUEXBR-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.12 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|