C44H83NO4 — CID 165381298
(1S,3R)-2-[3-(dimethylamino)propyl]-1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propane-1,3-diol (PubChem CID 165381298) has the molecular formula C44H83NO4 and a molecular weight of 690.15 g/mol. Its IUPAC name is (1S,3R)-2-[3-(dimethylamino)propyl]-1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propane-1,3-diol.
| Compound Name | (1S,3R)-2-[3-(dimethylamino)propyl]-1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 165381298 |
| Molecular Formula | C44H83NO4 |
| Molecular Weight | 690.15 g/mol |
| Exact Mass | 689.63 |
| IUPAC Name | (1S,3R)-2-[3-(dimethylamino)propyl]-1,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propane-1,3-diol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@@H](O)C(CCCN(C)C)[C@@H](O)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C44H83NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-48-43(46)42(38-37-39-45(3)4)44(47)49-41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-44,46-47H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20-/t42?,43-,44+ |
| InChIKey | XTSXICXOGMQMFM-UJXMBFPYSA-N |
| XLogP | 12.24 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.15 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|