C38H71NO2 — CID 164815643
3,4-bis[(9Z,12Z)-hexadeca-9,12-dienoxy]-N,N-dimethylbutan-1-amine (PubChem CID 164815643) has the molecular formula C38H71NO2 and a molecular weight of 573.99 g/mol. Its IUPAC name is 3,4-bis[(9Z,12Z)-hexadeca-9,12-dienoxy]-N,N-dimethylbutan-1-amine.
| Compound Name | 3,4-bis[(9Z,12Z)-hexadeca-9,12-dienoxy]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 164815643 |
| Molecular Formula | C38H71NO2 |
| Molecular Weight | 573.99 g/mol |
| Exact Mass | 573.55 |
| IUPAC Name | 3,4-bis[(9Z,12Z)-hexadeca-9,12-dienoxy]-N,N-dimethylbutan-1-amine |
| SMILES | CCC/C=C\C/C=C\CCCCCCCCOCC(CCN(C)C)OCCCCCCCC/C=C\C/C=C\CCC |
| InChI | InChI=1S/C38H71NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-40-37-38(33-34-39(3)4)41-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h9-12,15-18,38H,5-8,13-14,19-37H2,1-4H3/b11-9-,12-10-,17-15-,18-16- |
| InChIKey | ACQREUNUHWLKPH-DFIVFKFMSA-N |
| XLogP | 11.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.99 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|