C45H77NO2 — CID 76702087
2,3-bis(icosa-4,7,10,13-tetraenoxy)-N,N-dimethylpropan-1-amine (PubChem CID 76702087) has the molecular formula C45H77NO2 and a molecular weight of 664.12 g/mol. Its IUPAC name is 2,3-bis(icosa-4,7,10,13-tetraenoxy)-N,N-dimethylpropan-1-amine.
| Compound Name | 2,3-bis(icosa-4,7,10,13-tetraenoxy)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 76702087 |
| Molecular Formula | C45H77NO2 |
| Molecular Weight | 664.12 g/mol |
| Exact Mass | 663.60 |
| IUPAC Name | 2,3-bis(icosa-4,7,10,13-tetraenoxy)-N,N-dimethylpropan-1-amine |
| SMILES | CCCCCCC=CCC=CCC=CCC=CCCCOCC(CN(C)C)OCCCC=CCC=CCC=CCC=CCCCCCC |
| InChI | InChI=1S/C45H77NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-47-44-45(43-46(3)4)48-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h15-18,21-24,27-30,33-36,45H,5-14,19-20,25-26,31-32,37-44H2,1-4H3 |
| InChIKey | IBYVYHHVYWTZAD-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.12 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|