C41H81NO2 — CID 97102276
(2R)-N,N-dimethyl-2,3-bis[(Z)-octadec-9-enoxy]propan-1-amine (PubChem CID 97102276) has the molecular formula C41H81NO2 and a molecular weight of 620.10 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2,3-bis[(Z)-octadec-9-enoxy]propan-1-amine.
| Compound Name | (2R)-N,N-dimethyl-2,3-bis[(Z)-octadec-9-enoxy]propan-1-amine |
|---|---|
| PubChem CID | 97102276 |
| Molecular Formula | C41H81NO2 |
| Molecular Weight | 620.10 g/mol |
| Exact Mass | 619.63 |
| IUPAC Name | (2R)-N,N-dimethyl-2,3-bis[(Z)-octadec-9-enoxy]propan-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC[C@@H](CN(C)C)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C41H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43-40-41(39-42(3)4)44-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,41H,5-18,23-40H2,1-4H3/b21-19-,22-20-/t41-/m1/s1 |
| InChIKey | GLGLUQVVDHRLQK-UNUIOPIBSA-N |
| XLogP | 13.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.10 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|