C33H63NO3 — CID 131967763
[3-(dimethylamino)-2-[(Z)-tetradec-9-enoxy]propyl] (Z)-tetradec-9-enoate (PubChem CID 131967763) has the molecular formula C33H63NO3 and a molecular weight of 521.87 g/mol. Its IUPAC name is [3-(dimethylamino)-2-[(Z)-tetradec-9-enoxy]propyl] (Z)-tetradec-9-enoate.
| Compound Name | [3-(dimethylamino)-2-[(Z)-tetradec-9-enoxy]propyl] (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 131967763 |
| Molecular Formula | C33H63NO3 |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.48 |
| IUPAC Name | [3-(dimethylamino)-2-[(Z)-tetradec-9-enoxy]propyl] (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCCOC(COC(=O)CCCCCCC/C=C\CCCC)CN(C)C |
| InChI | InChI=1S/C33H63NO3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-36-32(30-34(3)4)31-37-33(35)28-26-24-22-20-18-16-14-12-10-8-6-2/h11-14,32H,5-10,15-31H2,1-4H3/b13-11-,14-12- |
| InChIKey | HARSAJKXVJNLPQ-XSYHWHKQSA-N |
| XLogP | 9.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|