C37H69NO4 — CID 123439877
[3-(dimethylamino)-2-hexadec-9-enoyloxypropyl] hexadec-9-enoate (PubChem CID 123439877) has the molecular formula C37H69NO4 and a molecular weight of 591.96 g/mol. Its IUPAC name is [3-(dimethylamino)-2-hexadec-9-enoyloxypropyl] hexadec-9-enoate.
| Compound Name | [3-(dimethylamino)-2-hexadec-9-enoyloxypropyl] hexadec-9-enoate |
|---|---|
| PubChem CID | 123439877 |
| Molecular Formula | C37H69NO4 |
| Molecular Weight | 591.96 g/mol |
| Exact Mass | 591.52 |
| IUPAC Name | [3-(dimethylamino)-2-hexadec-9-enoyloxypropyl] hexadec-9-enoate |
| SMILES | CCCCCCC=CCCCCCCCC(=O)OCC(CN(C)C)OC(=O)CCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C37H69NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36(39)41-34-35(33-38(3)4)42-37(40)32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h15-18,35H,5-14,19-34H2,1-4H3 |
| InChIKey | GTUNMVOGXXHDFS-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.96 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|