C42H84ClNO2 — CID 6438350
2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride (PubChem CID 6438350) has the molecular formula C42H84ClNO2 and a molecular weight of 670.59 g/mol. Its IUPAC name is 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride.
| Compound Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 6438350 |
| Molecular Formula | C42H84ClNO2 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 669.62 |
| IUPAC Name | 2,3-bis[(Z)-octadec-9-enoxy]propyl-trimethylazanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)C)OCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C42H84NO2.ClH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44-41-42(40-43(3,4)5)45-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,42H,6-19,24-41H2,1-5H3;1H/q+1;/p-1/b22-20-,23-21-; |
| InChIKey | LDGWQMRUWMSZIU-LQDDAWAPSA-M |
| XLogP | 10.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|