C44H88NO3+ — CID 71811919
2,3-bis[(E)-heptadec-9-enoxy]propyl-(5-hydroxypentyl)-dimethylazanium (PubChem CID 71811919) has the molecular formula C44H88NO3+ and a molecular weight of 679.19 g/mol. Its IUPAC name is 2,3-bis[(E)-heptadec-9-enoxy]propyl-(5-hydroxypentyl)-dimethylazanium.
| Compound Name | 2,3-bis[(E)-heptadec-9-enoxy]propyl-(5-hydroxypentyl)-dimethylazanium |
|---|---|
| PubChem CID | 71811919 |
| Molecular Formula | C44H88NO3+ |
| Molecular Weight | 679.19 g/mol |
| Exact Mass | 678.68 |
| IUPAC Name | 2,3-bis[(E)-heptadec-9-enoxy]propyl-(5-hydroxypentyl)-dimethylazanium |
| SMILES | CCCCCCC/C=C/CCCCCCCCOCC(C[N+](C)(C)CCCCCO)OCCCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C44H88NO3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-40-47-43-44(42-45(3,4)38-34-33-35-39-46)48-41-37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h17-20,44,46H,5-16,21-43H2,1-4H3/q+1/b19-17+,20-18+ |
| InChIKey | QVVMPPUNVCUBAU-XPWSMXQVSA-N |
| XLogP | 12.92 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.19 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|