C49H98NO5+ — CID 142827904
2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[3-[(Z)-icos-11-enoxy]-2-[(Z)-octadec-10-enoxy]propyl]-dimethylazanium (PubChem CID 142827904) has the molecular formula C49H98NO5+ and a molecular weight of 781.32 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[3-[(Z)-icos-11-enoxy]-2-[(Z)-octadec-10-enoxy]propyl]-dimethylazanium.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[3-[(Z)-icos-11-enoxy]-2-[(Z)-octadec-10-enoxy]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 142827904 |
| Molecular Formula | C49H98NO5+ |
| Molecular Weight | 781.32 g/mol |
| Exact Mass | 780.74 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[3-[(Z)-icos-11-enoxy]-2-[(Z)-octadec-10-enoxy]propyl]-dimethylazanium |
| SMILES | CCCCCCC/C=C\CCCCCCCCCOC(COCCCCCCCCCC/C=C\CCCCCCCC)C[N+](C)(C)CCOCCOCCO |
| InChI | InChI=1S/C49H98NO5/c1-5-7-9-11-13-15-17-19-21-23-24-25-27-29-31-33-35-37-41-54-48-49(47-50(3,4)39-43-52-45-46-53-44-40-51)55-42-38-36-34-32-30-28-26-22-20-18-16-14-12-10-8-6-2/h18-21,49,51H,5-17,22-48H2,1-4H3/q+1/b20-18-,21-19- |
| InChIKey | AQMOAKWTEOKZHM-AUYXYSRISA-N |
| XLogP | 13.35 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.32 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|