C45H90NO6+ — CID 24898691
2,3-bis[(Z)-hexadec-11-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium (PubChem CID 24898691) has the molecular formula C45H90NO6+ and a molecular weight of 741.22 g/mol. Its IUPAC name is 2,3-bis[(Z)-hexadec-11-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium.
| Compound Name | 2,3-bis[(Z)-hexadec-11-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 24898691 |
| Molecular Formula | C45H90NO6+ |
| Molecular Weight | 741.22 g/mol |
| Exact Mass | 740.68 |
| IUPAC Name | 2,3-bis[(Z)-hexadec-11-enoxy]propyl-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-dimethylazanium |
| SMILES | CCCC/C=C\CCCCCCCCCCOCC(C[N+](C)(C)CCOCCOCCOCCO)OCCCCCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C45H90NO6/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-51-44-45(43-46(3,4)33-37-48-39-41-50-42-40-49-38-34-47)52-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h11-14,45,47H,5-10,15-44H2,1-4H3/q+1/b13-11-,14-12- |
| InChIKey | GXQOBROJCLGPNV-XSYHWHKQSA-N |
| XLogP | 11.02 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.22 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|