C55H110ClNO8 — CID 87466456
6,6-bis[2-(2-hydroxyethoxy)ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride (PubChem CID 87466456) has the molecular formula C55H110ClNO8 and a molecular weight of 948.94 g/mol. Its IUPAC name is 6,6-bis[2-(2-hydroxyethoxy)ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride.
| Compound Name | 6,6-bis[2-(2-hydroxyethoxy)ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 87466456 |
| Molecular Formula | C55H110ClNO8 |
| Molecular Weight | 948.94 g/mol |
| Exact Mass | 947.79 |
| IUPAC Name | 6,6-bis[2-(2-hydroxyethoxy)ethoxy]hexyl-[2,3-bis[(Z)-octadec-9-enoxy]propyl]-dimethylazanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(C[N+](C)(C)CCCCCC(OCCOCCO)OCCOCCO)OCCCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C55H110NO8.ClH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-44-61-53-54(62-45-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)52-56(3,4)41-37-35-36-40-55(63-50-48-59-46-42-57)64-51-49-60-47-43-58;/h19-22,54-55,57-58H,5-18,23-53H2,1-4H3;1H/q+1;/p-1/b21-19-,22-20-; |
| InChIKey | UWOWTMDTCMWBKC-JDVCJPALSA-M |
| XLogP | 10.48 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.94 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|