C43H87N2O2+ — CID 73158232
2-aminoethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium (PubChem CID 73158232) has the molecular formula C43H87N2O2+ and a molecular weight of 664.18 g/mol. Its IUPAC name is 2-aminoethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium.
| Compound Name | 2-aminoethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 73158232 |
| Molecular Formula | C43H87N2O2+ |
| Molecular Weight | 664.18 g/mol |
| Exact Mass | 663.68 |
| IUPAC Name | 2-aminoethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(C[N+](C)(C)CCN)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C43H87N2O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-46-42-43(41-45(3,4)38-37-44)47-40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,43H,5-18,23-42,44H2,1-4H3/q+1 |
| InChIKey | VHAJDBUBFGEGMI-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.18 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|