C46H94N3O2+ — CID 85043126
2-(3-aminopropylamino)ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium (PubChem CID 85043126) has the molecular formula C46H94N3O2+ and a molecular weight of 721.28 g/mol. Its IUPAC name is 2-(3-aminopropylamino)ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium.
| Compound Name | 2-(3-aminopropylamino)ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 85043126 |
| Molecular Formula | C46H94N3O2+ |
| Molecular Weight | 721.28 g/mol |
| Exact Mass | 720.73 |
| IUPAC Name | 2-(3-aminopropylamino)ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(C[N+](C)(C)CCNCCCN)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C46H94N3O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42-50-45-46(44-49(3,4)41-40-48-39-37-38-47)51-43-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,46,48H,5-18,23-45,47H2,1-4H3/q+1 |
| InChIKey | KHNJHLQCOFLSFD-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.28 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|