C54H111N6O3+ — CID 54158358
2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium (PubChem CID 54158358) has the molecular formula C54H111N6O3+ and a molecular weight of 892.52 g/mol. Its IUPAC name is 2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium.
| Compound Name | 2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 54158358 |
| Molecular Formula | C54H111N6O3+ |
| Molecular Weight | 892.52 g/mol |
| Exact Mass | 891.87 |
| IUPAC Name | 2-[3-[4-(3-aminopropylamino)butylamino]propylcarbamoylamino]ethyl-[2,3-bis(octadec-9-enoxy)propyl]-dimethylazanium |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(C[N+](C)(C)CCNC(=O)NCCCNCCCCNCCCN)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C54H110N6O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-49-62-52-53(63-50-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)51-60(3,4)48-47-59-54(61)58-46-40-45-57-43-36-35-42-56-44-39-41-55/h19-22,53,56-57H,5-18,23-52,55H2,1-4H3,(H-,58,59,61)/p+1 |
| InChIKey | OMQQYFKQBAPSIC-UHFFFAOYSA-O |
| XLogP | 12.54 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.52 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|