C54H110N6O3 — CID 123978156
3-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-[2-[2,3-bis(octadec-9-enoxy)propyl-methylamino]ethyl]-1-methylurea (PubChem CID 123978156) has the molecular formula C54H110N6O3 and a molecular weight of 891.51 g/mol. Its IUPAC name is 3-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-[2-[2,3-bis(octadec-9-enoxy)propyl-methylamino]ethyl]-1-methylurea.
| Compound Name | 3-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-[2-[2,3-bis(octadec-9-enoxy)propyl-methylamino]ethyl]-1-methylurea |
|---|---|
| PubChem CID | 123978156 |
| Molecular Formula | C54H110N6O3 |
| Molecular Weight | 891.51 g/mol |
| Exact Mass | 890.86 |
| IUPAC Name | 3-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-[2-[2,3-bis(octadec-9-enoxy)propyl-methylamino]ethyl]-1-methylurea |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(CN(C)CCN(C)C(=O)NCCCNCCCCNCCCN)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C54H110N6O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-49-62-52-53(63-50-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)51-59(3)47-48-60(4)54(61)58-46-40-45-57-43-36-35-42-56-44-39-41-55/h19-22,53,56-57H,5-18,23-52,55H2,1-4H3,(H,58,61) |
| InChIKey | DHPDSOFMOIKIQM-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.51 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|