C53H105N3O7 — CID 101340237
(2S)-2,6-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]hexanamide (PubChem CID 101340237) has the molecular formula C53H105N3O7 and a molecular weight of 896.44 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 101340237 |
| Molecular Formula | C53H105N3O7 |
| Molecular Weight | 896.44 g/mol |
| Exact Mass | 895.80 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]hexanamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COCCOCCOCCOCCNC(=O)[C@@H](N)CCCCN)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C53H105N3O7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-40-61-49-51(63-41-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)50-62-48-47-60-46-45-59-44-43-58-42-39-56-53(57)52(55)37-33-34-38-54/h17-20,51-52H,3-16,21-50,54-55H2,1-2H3,(H,56,57)/b19-17-,20-18-/t51?,52-/m0/s1 |
| InChIKey | CHOCMJMDPKWHPA-ZRNPVEGFSA-N |
| XLogP | 12.10 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.44 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|