C54H106N2O10 — CID 166948476
2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 2-[2-(1-amino-2-methoxyethoxy)ethylamino]acetate (PubChem CID 166948476) has the molecular formula C54H106N2O10 and a molecular weight of 943.45 g/mol. Its IUPAC name is 2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 2-[2-(1-amino-2-methoxyethoxy)ethylamino]acetate.
| Compound Name | 2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 2-[2-(1-amino-2-methoxyethoxy)ethylamino]acetate |
|---|---|
| PubChem CID | 166948476 |
| Molecular Formula | C54H106N2O10 |
| Molecular Weight | 943.45 g/mol |
| Exact Mass | 942.78 |
| IUPAC Name | 2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl 2-[2-(1-amino-2-methoxyethoxy)ethylamino]acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COCCOCCOCCOCCOC(=O)CNCCOC(N)COC)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C54H106N2O10/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-62-49-52(64-38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)50-63-45-44-60-41-40-59-42-43-61-46-47-66-54(57)48-56-36-39-65-53(55)51-58-3/h18-21,52-53,56H,4-17,22-51,55H2,1-3H3/b20-18-,21-19- |
| InChIKey | OIINSCHRQXTJJX-AUYXYSRISA-N |
| XLogP | 11.61 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.45 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|