C56H106N2O12 — CID 166948438
2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)acetate (PubChem CID 166948438) has the molecular formula C56H106N2O12 and a molecular weight of 999.47 g/mol. Its IUPAC name is 2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)acetate.
| Compound Name | 2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)acetate |
|---|---|
| PubChem CID | 166948438 |
| Molecular Formula | C56H106N2O12 |
| Molecular Weight | 999.47 g/mol |
| Exact Mass | 998.77 |
| IUPAC Name | 2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2-oxoethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COC(=O)COCCOCCOCCOC(=O)CNCCOC(=O)CNCCOC)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C56H106N2O12/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-65-50-53(67-39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)51-70-56(61)52-66-45-44-63-42-43-64-46-47-69-55(60)49-58-37-41-68-54(59)48-57-36-40-62-3/h18-21,53,57-58H,4-17,22-52H2,1-3H3/b20-18-,21-19- |
| InChIKey | DRPIUXRFUHRPFT-AUYXYSRISA-N |
| XLogP | 10.97 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.47 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|