C57H110N2O11 — CID 166948211
2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)propanoate (PubChem CID 166948211) has the molecular formula C57H110N2O11 and a molecular weight of 999.51 g/mol. Its IUPAC name is 2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)propanoate.
| Compound Name | 2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)propanoate |
|---|---|
| PubChem CID | 166948211 |
| Molecular Formula | C57H110N2O11 |
| Molecular Weight | 999.51 g/mol |
| Exact Mass | 998.81 |
| IUPAC Name | 2-[[2-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-oxoethyl]amino]ethyl 2-(2-methoxyethylamino)propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COCCOCCOCCOCCOC(=O)CNCCOC(=O)C(C)NCCOC)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C57H110N2O11/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-66-52-55(68-40-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)53-67-48-47-64-44-43-63-45-46-65-49-50-69-56(60)51-58-37-42-70-57(61)54(3)59-38-41-62-4/h19-22,54-55,58-59H,5-18,23-53H2,1-4H3/b21-19-,22-20- |
| InChIKey | FGODSTNOMKOWCN-WRBBJXAJSA-N |
| XLogP | 11.83 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.51 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|