C50H97N3O7 — CID 162442712
(Z)-2,3-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide (PubChem CID 162442712) has the molecular formula C50H97N3O7 and a molecular weight of 852.34 g/mol. Its IUPAC name is (Z)-2,3-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide.
| Compound Name | (Z)-2,3-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 162442712 |
| Molecular Formula | C50H97N3O7 |
| Molecular Weight | 852.34 g/mol |
| Exact Mass | 851.73 |
| IUPAC Name | (Z)-2,3-diamino-N-[2-[2-[2-[2-[2,3-bis[(Z)-octadec-9-enoxy]propoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COCCOCCOCCOCCNC(=O)/C(N)=C/N)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C50H97N3O7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-58-46-48(60-37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)47-59-44-43-57-42-41-56-40-39-55-38-35-53-50(54)49(52)45-51/h17-20,45,48H,3-16,21-44,46-47,51-52H2,1-2H3,(H,53,54)/b19-17-,20-18-,49-45- |
| InChIKey | FOTABKIAKYWLHJ-GFTOMINXSA-N |
| XLogP | 11.40 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.34 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|