C9H19N3O — CID 89150750
(E)-2,3-diamino-N-hexylprop-2-enamide (PubChem CID 89150750) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (E)-2,3-diamino-N-hexylprop-2-enamide.
| Compound Name | (E)-2,3-diamino-N-hexylprop-2-enamide |
|---|---|
| PubChem CID | 89150750 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (E)-2,3-diamino-N-hexylprop-2-enamide |
| SMILES | CCCCCCNC(=O)/C(N)=C\N |
| InChI | InChI=1S/C9H19N3O/c1-2-3-4-5-6-12-9(13)8(11)7-10/h7H,2-6,10-11H2,1H3,(H,12,13)/b8-7+ |
| InChIKey | IWBDQMCMDOBZPB-BQYQJAHWSA-N |
| XLogP | 0.44 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|