About pentylurea;hydrate
pentylurea;hydrate (PubChem CID 172845599) has the molecular formula C6H16N2O2
and a molecular weight of 148.21 g/mol. Its IUPAC name is pentylurea;hydrate.
Molecular Properties
| Compound Name | pentylurea;hydrate |
| PubChem CID | 172845599 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | pentylurea;hydrate |
| SMILES | CCCCCNC(N)=O.O |
| InChI | InChI=1S/C6H14N2O.H2O/c1-2-3-4-5-8-6(7)9;/h2-5H2,1H3,(H3,7,8,9);1H2 |
| InChIKey | HVKIDRCBNBLMFU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentylurea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentylurea;hydrate?
The IUPAC name of pentylurea;hydrate (CID 172845599) is pentylurea;hydrate.
What is the SMILES notation for pentylurea;hydrate?
The canonical SMILES for pentylurea;hydrate is CCCCCNC(N)=O.O.
What is the InChIKey of pentylurea;hydrate?
The InChIKey is HVKIDRCBNBLMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.H2O/c1-2-3-4-5-8-6(7)9;/h2-5H2,1H3,(H3,7,8,9);1H2.
What are the key properties of pentylurea;hydrate?
pentylurea;hydrate has a molecular weight of 148.21 g/mol, XLogP of 0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentylurea;hydrate is sourced from PubChem (CID 172845599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).